https://bbip.genouest.org/index.php?action=history&feed=atom&title=PROTOPORPHYRIN_IX 2026-04-11T12:41:08Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=PROTOPORPHYRIN_IX&diff=29469&oldid=prev 2020-10-09T10:52:53Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite PROTOPORPHYRIN_IX == * common-name: ** protoporphyrin ix * inchi-key: ** ksfovussgskxfi-ujjxfscmsa-l * molecular-weight: ** 560.651 * smi...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite PROTOPORPHYRIN_IX ==<br /> * common-name:<br /> ** protoporphyrin ix<br /> * inchi-key:<br /> ** ksfovussgskxfi-ujjxfscmsa-l<br /> * molecular-weight:<br /> ** 560.651<br /> * smiles:<br /> ** c=cc4(\c(/c)=c3(\c=c5(c(/c)=c(ccc([o-])=o)/c(\c=c1(c(/ccc([o-])=o)=c(c)/c(/n1)=c/c2(/c(\c=c)=c(c)\c(\n=2)=c\c(\n3)=4)))=n\5)))<br /> == Reaction(s) known to consume the compound ==<br /> * [[PROTOHEMEFERROCHELAT-RXN]]<br /> * [[RXN1F-20]]<br /> == Reaction(s) known to produce the compound ==<br /> * [[PROTOHEMEFERROCHELAT-RXN]]<br /> * [[PROTOPORGENOXI-RXN]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=protoporphyrin ix}}<br /> {{#set: inchi-key=inchikey=ksfovussgskxfi-ujjxfscmsa-l}}<br /> {{#set: molecular-weight=560.651}}</div>

Admin