https://bbip.genouest.org/index.php?action=history&feed=atom&title=NEUROSPORENE 2026-04-22T07:20:34Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=NEUROSPORENE&diff=26966&oldid=prev 2020-10-09T10:45:53Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite NEUROSPORENE == * common-name: ** all-trans neurosporene * inchi-key: ** atcicvfrsjqydv-xilukmicsa-n * molecular-weight: ** 538.898 * smi...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite NEUROSPORENE ==<br /> * common-name:<br /> ** all-trans neurosporene<br /> * inchi-key:<br /> ** atcicvfrsjqydv-xilukmicsa-n<br /> * molecular-weight:<br /> ** 538.898<br /> * smiles:<br /> ** cc(c)=cccc(\c)=c/c=c/c(\c)=c/c=c/c(\c)=c/c=c/c=c(c)/c=c/c=c(c)/cc/c=c(c)/ccc=c(c)c<br /> == Reaction(s) known to consume the compound ==<br /> * [[RXN-19141]]<br /> * [[RXN-8038]]<br /> * [[RXN-8040]]<br /> == Reaction(s) known to produce the compound ==<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=all-trans neurosporene}}<br /> {{#set: inchi-key=inchikey=atcicvfrsjqydv-xilukmicsa-n}}<br /> {{#set: molecular-weight=538.898}}</div>

Admin