https://bbip.genouest.org/index.php?action=history&feed=atom&title=GERANYLGERANYL-PP 2026-04-11T00:33:21Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=GERANYLGERANYL-PP&diff=29685&oldid=prev 2020-10-09T10:53:29Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite GERANYLGERANYL-PP == * common-name: ** geranylgeranyl diphosphate * inchi-key: ** oinneunvozhbox-qircyjposa-k * molecular-weight: ** 447....&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite GERANYLGERANYL-PP ==<br /> * common-name:<br /> ** geranylgeranyl diphosphate<br /> * inchi-key:<br /> ** oinneunvozhbox-qircyjposa-k<br /> * molecular-weight:<br /> ** 447.424<br /> * smiles:<br /> ** cc(c)=cccc(\c)=c/ccc(\c)=c/ccc(\c)=c/cop(=o)([o-])op(=o)([o-])[o-]<br /> == Reaction(s) known to consume the compound ==<br /> * [[2.5.1.32-RXN]]<br /> * [[5.5.1.13-RXN]]<br /> * [[RXN-10441]]<br /> * [[RXN-10625]]<br /> * [[RXN-11486]]<br /> * [[RXN-13323]]<br /> * [[RXN-19668]]<br /> * [[RXN-19995]]<br /> * [[RXN-19996]]<br /> * [[RXN-19997]]<br /> * [[RXN-3701]]<br /> * [[RXN-7658]]<br /> * [[RXN-7663]]<br /> * [[RXN-8813]]<br /> == Reaction(s) known to produce the compound ==<br /> * [[FARNESYLTRANSTRANSFERASE-RXN]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=geranylgeranyl diphosphate}}<br /> {{#set: inchi-key=inchikey=oinneunvozhbox-qircyjposa-k}}<br /> {{#set: molecular-weight=447.424}}</div>

Admin