https://bbip.genouest.org/index.php?action=history&feed=atom&title=FARNESYL-PP 2026-04-22T13:10:46Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=FARNESYL-PP&diff=28369&oldid=prev 2020-10-09T10:49:34Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite FARNESYL-PP == * common-name: ** (2e,6e)-farnesyl diphosphate * inchi-key: ** vwfjdquyciwhtn-yfvjmotdsa-k * molecular-weight: ** 379.306...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite FARNESYL-PP ==<br /> * common-name:<br /> ** (2e,6e)-farnesyl diphosphate<br /> * inchi-key:<br /> ** vwfjdquyciwhtn-yfvjmotdsa-k<br /> * molecular-weight:<br /> ** 379.306<br /> * smiles:<br /> ** cc(c)=cccc(\c)=c/ccc(\c)=c/cop(op([o-])(=o)[o-])(=o)[o-]<br /> == Reaction(s) known to consume the compound ==<br /> &lt;div class=&quot;toccolours mw-collapsible mw-collapsed&quot; style=&quot;width:100%; overflow:auto;&quot;&gt;<br /> * [[4.6.1.11-RXN]]<br /> * [[FARNESYLTRANSTRANSFERASE-RXN]]<br /> * [[HEMEOSYN-RXN]]<br /> * [[RXN-10005]]<br /> * [[RXN-11963]]<br /> * [[RXN-12263]]<br /> * [[RXN-13162]]<br /> * [[RXN-17573]]<br /> * [[RXN-8414]]<br /> * [[RXN-8415]]<br /> * [[RXN-8416]]<br /> * [[RXN-8417]]<br /> * [[RXN-8418]]<br /> * [[RXN-8422]]<br /> * [[RXN-8424]]<br /> * [[RXN-8425]]<br /> * [[RXN-8426]]<br /> * [[RXN-8430]]<br /> * [[RXN-8562]]<br /> * [[RXN-8574]]<br /> * [[RXN-8648]]<br /> * [[RXN-8939]]<br /> * [[RXN-8992]]<br /> * [[RXN-9969]]<br /> * [[TRANS-HEXAPRENYLTRANSTRANSFERASE-RXN]]<br /> * [[TRANS-PENTAPRENYLTRANSFERASE-RXN]]<br /> &lt;/div&gt;<br /> == Reaction(s) known to produce the compound ==<br /> * [[FPPSYN-RXN]]<br /> * [[RXN-11963]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=(2e,6e)-farnesyl diphosphate}}<br /> {{#set: inchi-key=inchikey=vwfjdquyciwhtn-yfvjmotdsa-k}}<br /> {{#set: molecular-weight=379.306}}</div>

Admin