https://bbip.genouest.org/index.php?action=history&feed=atom&title=DELTA3-ISOPENTENYL-PP 2026-04-27T02:05:41Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=DELTA3-ISOPENTENYL-PP&diff=27741&oldid=prev 2020-10-09T10:47:58Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite DELTA3-ISOPENTENYL-PP == * common-name: ** isopentenyl diphosphate * inchi-key: ** nuhsrofqtuxzqq-uhfffaoysa-k * molecular-weight: ** 243...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite DELTA3-ISOPENTENYL-PP ==<br /> * common-name:<br /> ** isopentenyl diphosphate<br /> * inchi-key:<br /> ** nuhsrofqtuxzqq-uhfffaoysa-k<br /> * molecular-weight:<br /> ** 243.069<br /> * smiles:<br /> ** c=c(c)ccop([o-])(=o)op([o-])(=o)[o-]<br /> == Reaction(s) known to consume the compound ==<br /> * [[2.5.1.20-RXN]]<br /> * [[DIMETHYLALLYLCISTRANSFERASE-RXN]]<br /> * [[FARNESYLTRANSTRANSFERASE-RXN]]<br /> * [[FPPSYN-RXN]]<br /> * [[GPPSYN-RXN]]<br /> * [[IPPISOM-RXN]]<br /> * [[RXN-10068]]<br /> * [[RXN-11486]]<br /> * [[RXN-11963]]<br /> * [[RXN-8813]]<br /> * [[RXN-8992]]<br /> * [[RXN-9137]]<br /> * [[RXN-9969]]<br /> * [[TRANS-HEXAPRENYLTRANSTRANSFERASE-RXN]]<br /> * [[TRANS-OCTAPRENYLTRANSTRANSFERASE-RXN]]<br /> * [[TRANS-PENTAPRENYLTRANSFERASE-RXN]]<br /> == Reaction(s) known to produce the compound ==<br /> * [[2.5.1.20-RXN]]<br /> * [[DIPHOSPHOMEVALONTE-DECARBOXYLASE-RXN]]<br /> * [[IPPISOM-RXN]]<br /> * [[ISPH2-RXN]]<br /> * [[RXN-10068]]<br /> * [[RXN-11963]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=isopentenyl diphosphate}}<br /> {{#set: inchi-key=inchikey=nuhsrofqtuxzqq-uhfffaoysa-k}}<br /> {{#set: molecular-weight=243.069}}</div>

Admin