https://bbip.genouest.org/index.php?action=history&feed=atom&title=CPD-9529 2026-04-12T18:00:31Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=CPD-9529&diff=29436&oldid=prev 2020-10-09T10:52:45Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite CPD-9529 == * common-name: ** hemigossypol-6-methyl ether * inchi-key: ** xoxrfbvthnrdny-uhfffaoysa-n * molecular-weight: ** 274.316 * sm...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite CPD-9529 ==<br /> * common-name:<br /> ** hemigossypol-6-methyl ether<br /> * inchi-key:<br /> ** xoxrfbvthnrdny-uhfffaoysa-n<br /> * molecular-weight:<br /> ** 274.316<br /> * smiles:<br /> ** cc(c1(/c2(\c=c(c)/c=c(c(\c(\c=o)=c(c(/oc)=1)\o)=2)/o)))c<br /> == Reaction(s) known to consume the compound ==<br /> * [[RXN-9051]]<br /> == Reaction(s) known to produce the compound ==<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=hemigossypol-6-methyl ether}}<br /> {{#set: inchi-key=inchikey=xoxrfbvthnrdny-uhfffaoysa-n}}<br /> {{#set: molecular-weight=274.316}}</div>

Admin