https://bbip.genouest.org/index.php?action=history&feed=atom&title=CPD-9527 2026-04-26T03:43:18Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=CPD-9527&diff=27638&oldid=prev 2020-10-09T10:47:41Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite CPD-9527 == * common-name: ** gossypol-6,6&#039;-dimethyl ether * inchi-key: ** ouhoxiplbjiweg-uhfffaoysa-n * molecular-weight: ** 546.616 * s...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite CPD-9527 ==<br /> * common-name:<br /> ** gossypol-6,6'-dimethyl ether<br /> * inchi-key:<br /> ** ouhoxiplbjiweg-uhfffaoysa-n<br /> * molecular-weight:<br /> ** 546.616<br /> * smiles:<br /> ** cc(c1(/c4(c(c(\c=o)=c(c(/oc)=1)\o)=c(o)c(/c3(/c(o)=c2(c(c(\c(c)c)=c(c(\o)=c2\c=o)/oc)=cc(/c)=3)))=c(c)/c=4)))c<br /> == Reaction(s) known to consume the compound ==<br /> == Reaction(s) known to produce the compound ==<br /> * [[RXN-9051]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=gossypol-6,6'-dimethyl ether}}<br /> {{#set: inchi-key=inchikey=ouhoxiplbjiweg-uhfffaoysa-n}}<br /> {{#set: molecular-weight=546.616}}</div>

Admin