https://bbip.genouest.org/index.php?action=history&feed=atom&title=CPD-7535 CPD-7535 - Revision history 2026-04-11T13:10:27Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=CPD-7535&diff=30113&oldid=prev Admin: Created page with "Category:metabolite == Metabolite CPD-7535 == * common-name: ** 9,15,9'-tri-cis-&zeta;-carotene * inchi-key: ** biwlelkafxrpde-lmarsqgmsa-n * molecular-weight: ** 540.914..." 2020-10-09T10:54:36Z <p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite CPD-7535 == * common-name: ** 9,15,9&#039;-tri-cis-ΞΆ-carotene * inchi-key: ** biwlelkafxrpde-lmarsqgmsa-n * molecular-weight: ** 540.914...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite CPD-7535 ==<br /> * common-name:<br /> ** 9,15,9'-tri-cis-&amp;zeta;-carotene<br /> * inchi-key:<br /> ** biwlelkafxrpde-lmarsqgmsa-n<br /> * molecular-weight:<br /> ** 540.914<br /> * smiles:<br /> ** cc(c)=cccc(\c)=c/ccc(/c)=c/c=c/c(\c)=c/c=c\c=c(c)\c=c\c=c(c)/cc/c=c(c)/ccc=c(c)c<br /> == Reaction(s) known to consume the compound ==<br /> * [[RXN-11354]]<br /> == Reaction(s) known to produce the compound ==<br /> * [[RXN-11354]]<br /> * [[RXN-11355]]<br /> * [[RXN-12244]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=9,15,9'-tri-cis-&amp;zeta;-carotene}}<br /> {{#set: inchi-key=inchikey=biwlelkafxrpde-lmarsqgmsa-n}}<br /> {{#set: molecular-weight=540.914}}</div> Admin