https://bbip.genouest.org/index.php?action=history&feed=atom&title=CPD-12588 2026-04-13T21:11:57Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=CPD-12588&diff=28745&oldid=prev 2020-10-09T10:50:34Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite CPD-12588 == * common-name: ** norsolorinate anthrone * inchi-key: ** cifxltlzycptjk-uhfffaoysa-l * molecular-weight: ** 354.359 * smiles...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite CPD-12588 ==<br /> * common-name:<br /> ** norsolorinate anthrone<br /> * inchi-key:<br /> ** cifxltlzycptjk-uhfffaoysa-l<br /> * molecular-weight:<br /> ** 354.359<br /> * smiles:<br /> ** cccccc(=o)c1(/c(/[o-])=c\c2(/cc3(/c=c(/c=c(c(/c(=o)c(\c(\o)=1)=2)=3)/o)/[o-])))<br /> == Reaction(s) known to consume the compound ==<br /> == Reaction(s) known to produce the compound ==<br /> * [[RXN-9479]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=norsolorinate anthrone}}<br /> {{#set: inchi-key=inchikey=cifxltlzycptjk-uhfffaoysa-l}}<br /> {{#set: molecular-weight=354.359}}</div>

Admin