https://bbip.genouest.org/index.php?action=history&feed=atom&title=CONIFERYL-ALCOHOL 2026-04-10T15:31:26Z Revision history for this page on the wiki MediaWiki 1.28.1 https://bbip.genouest.org/sp/brassica_napus/aureme/index.php?title=CONIFERYL-ALCOHOL&diff=29476&oldid=prev 2020-10-09T10:52:54Z

<p>Created page with &quot;<a href="/sp/brassica_napus/aureme/index.php/Category:Metabolite" title="Category:Metabolite">Category:metabolite</a> == Metabolite CONIFERYL-ALCOHOL == * common-name: ** coniferyl alcohol * inchi-key: ** jmfrwrfflbvwsi-nscuhmnnsa-n * molecular-weight: ** 180.203 * smi...&quot;</p> <p><b>New page</b></p><div>[[Category:metabolite]]<br /> == Metabolite CONIFERYL-ALCOHOL ==<br /> * common-name:<br /> ** coniferyl alcohol<br /> * inchi-key:<br /> ** jmfrwrfflbvwsi-nscuhmnnsa-n<br /> * molecular-weight:<br /> ** 180.203<br /> * smiles:<br /> ** coc1(\c(\o)=c/c=c(/c=c/co)/c=1)<br /> == Reaction(s) known to consume the compound ==<br /> * [[2.4.1.111-RXN]]<br /> * [[RXN-17351]]<br /> * [[RXN-17352]]<br /> * [[RXN-2602]]<br /> * [[RXN-9244]]<br /> == Reaction(s) known to produce the compound ==<br /> * [[CONIFERIN-BETA-GLUCOSIDASE-RXN]]<br /> * [[RXN-2602]]<br /> == Reaction(s) of unknown directionality ==<br /> {{#set: common-name=coniferyl alcohol}}<br /> {{#set: inchi-key=inchikey=jmfrwrfflbvwsi-nscuhmnnsa-n}}<br /> {{#set: molecular-weight=180.203}}</div>

Admin